| Name | Alpha-Phenylcyclopentaneacetic acid |
| Synonyms | CYCLOPENTYLPHENYLACETIC ACID cyclopentyl(phenyl)acetic acid Acetic acid, cyclopentyphenyl- Acetic acid, cyclopentylphenyl- A-PHENYLCYCLOPENTANEACETIC ACID 2-CYCLOPENTYL-2-PHENYLACETIC ACID (2R)-cyclopentyl(phenyl)ethanoate CYCLOPENTYL-2-PHENYLETHANOIC ACID (2S)-cyclopentyl(phenyl)ethanoate alpha-Cyclopentylphenylacetic acid alpha-Phenylcyclopentylacetic acid alpha-cyclopentyl-benzeneaceticaci Alpha-Phenylcyclopentaneacetic acid (2R)-cyclopentyl(phenyl)ethanoic acid Cyclopentaneacetic acid, alpha-phenyl- |
| CAS | 3900-93-4 |
| EINECS | 223-454-3 |
| InChI | InChI=1/C13H16O2/c14-13(15)12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2,(H,14,15)/p-1/t12-/m0/s1 |
| Molecular Formula | C13H16O2 |
| Molar Mass | 204.26 |
| Density | 1.0404 (rough estimate) |
| Melting Point | 98-100°C(lit.) |
| Boling Point | 302.76°C (rough estimate) |
| Flash Point | 234.2°C |
| Water Solubility | Insoluble in water. |
| Solubility | methanol: soluble50mg/mL, clear, colorless |
| Vapor Presure | 4.17E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow to Light orange |
| BRN | 1956835 |
| pKa | 4.36±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5180 (estimate) |
| MDL | MFCD00001379 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163900 |
| Hazard Class | IRRITANT |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |